2-amino-1-(3-methoxyphenyl)ethanone hydrochloride (1:1)

2-amino-1-(3-methoxyphenyl)ethanone hydrochloride (1:1) - Names and Identifiers

Name	2-amino-1-(3-methoxyphenyl)ethanone hydrochloride (1:1)
Synonyms	LogP 2-AMino-3'-Methoxyacetophenone HCl 2-(3-Methoxyphenyl)-2-oxoethanaminiumchlorid 2-(3-Methoxyphenyl)-2-oxoethanaminium chloride [2-(3-methoxyphenyl)-2-oxoethyl]azanium chloride [2-(3-methoxyphenyl)-2-oxo-ethyl]azanium chloride 2-(3-methoxyphenyl)-2-oxoethan-1-aminium chloride [2-keto-2-(3-methoxyphenyl)ethyl]ammonium chloride 2-AMINO-1-(3-METHOXY-PHENYL)-ETHANONE HYDROCHLORIDE 2-(3-METHOXY-PHENYL)-2-OXO-ETHYL-AMMONIUM, CHLORIDE 2-aMino-1-(3-Methoxyphenyl)ethan-1-one hydrochloride
CAS	24037-72-7
InChI	InChI=1/C9H11NO2.ClH/c1-12-8-4-2-3-7(5-8)9(11)6-10;/h2-5H,6,10H2,1H3;1H

2-amino-1-(3-methoxyphenyl)ethanone hydrochloride (1:1) - Physico-chemical Properties

Molecular Formula	C9H12ClNO2
Molar Mass	201.65
Melting Point	182-183 °C
Boling Point	320.2°C at 760 mmHg
Flash Point	147.5°C
Vapor Presure	0.000235mmHg at 25°C
Storage Condition	Room Temprature

2-amino-1-(3-methoxyphenyl)ethanone hydrochloride (1:1) - Introduction

2-amino-1-(3-methoxyphenyl)ethanone hydrochloride (1:1) is an organic compound with the chemical formula C9H12ClNO2. The following is a description of the relevant Properties, Uses, methods and safety information:

Nature:
1. Appearance: White crystalline solid.
2. Melting point: About 140-142 ° C.
3. Solubility: soluble in water and ethanol, slightly soluble in ether.

Use:
This compound is commonly used as an intermediate in organic synthesis. It can be used as a starting material or an important intermediate in the synthesis of drugs, dyes and other organic compounds.

Method:
2-amino-1-(3-methoxyphenyl)ethanone hydrochloride (1:1) can be prepared by the following steps:
1. 3-methoxyacetophenone is reacted with anhydrous ethanol and excess ammonia.
2. Add hydrochloric acid to the reaction mixture.
3. Crystallization and separation and purification.

Safety Information:
1. This compound is stable at room temperature, but should avoid contact with strong oxidants.
2. When preparing or handling this compound, take appropriate protective measures, such as wearing protective glasses and gloves.
3. The general toxicity of this hydrochloride compound is low, but it is still recommended to maintain good laboratory operating habits during use and follow relevant safety operating procedures.

Last Update：2024-04-09 15:17:56